About butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate
butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate (PubChem CID 87340400) has the molecular formula C17H31F3O2S
and a molecular weight of 356.49 g/mol. Its IUPAC name is butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate.
Molecular Properties
| Compound Name | butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
| PubChem CID | 87340400 |
| Molecular Formula | C17H31F3O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
| SMILES | CCCCOC(=O)C(CC(C)C)SCCCCCCC(F)(F)F |
| InChI | InChI=1S/C17H31F3O2S/c1-4-5-11-22-16(21)15(13-14(2)3)23-12-9-7-6-8-10-17(18,19)20/h14-15H,4-13H2,1-3H3 |
| InChIKey | QMPNEILSHYEBNQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate?
The IUPAC name of butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate (CID 87340400) is butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate.
What is the SMILES notation for butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate?
The canonical SMILES for butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate is CCCCOC(=O)C(CC(C)C)SCCCCCCC(F)(F)F.
What is the InChIKey of butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate?
The InChIKey is QMPNEILSHYEBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31F3O2S/c1-4-5-11-22-16(21)15(13-14(2)3)23-12-9-7-6-8-10-17(18,19)20/h14-15H,4-13H2,1-3H3.
What are the key properties of butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate?
butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate has a molecular weight of 356.49 g/mol, XLogP of 5.99, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate is sourced from PubChem (CID 87340400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).