About propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate
propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate (PubChem CID 87340441) has the molecular formula C16H30F2O2S
and a molecular weight of 324.48 g/mol. Its IUPAC name is propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate.
Molecular Properties
| Compound Name | propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate |
| PubChem CID | 87340441 |
| Molecular Formula | C16H30F2O2S |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate |
| SMILES | CCCOC(=O)C(CC(C)C)SCCCC(F)(F)CCC |
| InChI | InChI=1S/C16H30F2O2S/c1-5-8-16(17,18)9-7-11-21-14(12-13(3)4)15(19)20-10-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | YYWOMBFWICMXEY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate?
The IUPAC name of propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate (CID 87340441) is propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate.
What is the SMILES notation for propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate?
The canonical SMILES for propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate is CCCOC(=O)C(CC(C)C)SCCCC(F)(F)CCC.
What is the InChIKey of propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate?
The InChIKey is YYWOMBFWICMXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F2O2S/c1-5-8-16(17,18)9-7-11-21-14(12-13(3)4)15(19)20-10-6-2/h13-14H,5-12H2,1-4H3.
What are the key properties of propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate?
propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate has a molecular weight of 324.48 g/mol, XLogP of 5.30, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(4,4-difluoroheptylsulfanyl)-4-methylpentanoate is sourced from PubChem (CID 87340441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).