C17H27F7O2S — CID 87340452
butyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate (PubChem CID 87340452) has the molecular formula C17H27F7O2S and a molecular weight of 428.45 g/mol. Its IUPAC name is butyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate.
| Compound Name | butyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 87340452 |
| Molecular Formula | C17H27F7O2S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | butyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate |
| SMILES | CCCCOC(=O)C(CC(C)C)SCCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H27F7O2S/c1-4-5-9-26-14(25)13(11-12(2)3)27-10-7-6-8-15(18,19)16(20,21)17(22,23)24/h12-13H,4-11H2,1-3H3 |
| InChIKey | YVMZSVOGKRWUBF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|