2-(3-fluoropropylsulfanyl)hexanoic acid

C9H17FO2S — CID 87340482

IUPAC2-(3-fluoropropylsulfanyl)hexanoic acid
SMILESCCCCC(SCCCF)C(=O)O
InChIInChI=1S/C9H17FO2S/c1-2-3-5-8(9(11)12)13-7-4-6-10/h8H,2-7H2,1H3,(H,11,12)
InChIKeyOBSILITYVLVYFX-UHFFFAOYSA-N
MW208.30 g/mol
LogP2.72
Rot. Bonds8

About 2-(3-fluoropropylsulfanyl)hexanoic acid

2-(3-fluoropropylsulfanyl)hexanoic acid (PubChem CID 87340482) has the molecular formula C9H17FO2S and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(3-fluoropropylsulfanyl)hexanoic acid.

Molecular Properties

Compound Name2-(3-fluoropropylsulfanyl)hexanoic acid
PubChem CID87340482
Molecular FormulaC9H17FO2S
Molecular Weight208.30 g/mol
Exact Mass208.09
IUPAC Name2-(3-fluoropropylsulfanyl)hexanoic acid
SMILESCCCCC(SCCCF)C(=O)O
InChIInChI=1S/C9H17FO2S/c1-2-3-5-8(9(11)12)13-7-4-6-10/h8H,2-7H2,1H3,(H,11,12)
InChIKeyOBSILITYVLVYFX-UHFFFAOYSA-N
XLogP2.72
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.30
LogP ≤ 52.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3-fluoropropylsulfanyl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-fluoropropylsulfanyl)hexanoic acid?
The IUPAC name of 2-(3-fluoropropylsulfanyl)hexanoic acid (CID 87340482) is 2-(3-fluoropropylsulfanyl)hexanoic acid.
What is the SMILES notation for 2-(3-fluoropropylsulfanyl)hexanoic acid?
The canonical SMILES for 2-(3-fluoropropylsulfanyl)hexanoic acid is CCCCC(SCCCF)C(=O)O.
What is the InChIKey of 2-(3-fluoropropylsulfanyl)hexanoic acid?
The InChIKey is OBSILITYVLVYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FO2S/c1-2-3-5-8(9(11)12)13-7-4-6-10/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 2-(3-fluoropropylsulfanyl)hexanoic acid?
2-(3-fluoropropylsulfanyl)hexanoic acid has a molecular weight of 208.30 g/mol, XLogP of 2.72, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoropropylsulfanyl)hexanoic acid is sourced from PubChem (CID 87340482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).