C11H17F5O2S — CID 87340497
3,3-dimethyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoic acid (PubChem CID 87340497) has the molecular formula C11H17F5O2S and a molecular weight of 308.31 g/mol. Its IUPAC name is 3,3-dimethyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 87340497 |
| Molecular Formula | C11H17F5O2S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3,3-dimethyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoic acid |
| SMILES | CC(C)(C)C(SCCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H17F5O2S/c1-9(2,3)7(8(17)18)19-6-4-5-10(12,13)11(14,15)16/h7H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | UIEHHMWFZUXHDU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|