C10H15F5O2S — CID 87340510
methyl 3-methyl-2-(3,3,4,4,4-pentafluorobutylsulfanyl)butanoate (PubChem CID 87340510) has the molecular formula C10H15F5O2S and a molecular weight of 294.29 g/mol. Its IUPAC name is methyl 3-methyl-2-(3,3,4,4,4-pentafluorobutylsulfanyl)butanoate.
| Compound Name | methyl 3-methyl-2-(3,3,4,4,4-pentafluorobutylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87340510 |
| Molecular Formula | C10H15F5O2S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | methyl 3-methyl-2-(3,3,4,4,4-pentafluorobutylsulfanyl)butanoate |
| SMILES | COC(=O)C(SCCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H15F5O2S/c1-6(2)7(8(16)17-3)18-5-4-9(11,12)10(13,14)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | BCINHRVBSAELRM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|