C14H21F7O2S — CID 87340526
methyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate (PubChem CID 87340526) has the molecular formula C14H21F7O2S and a molecular weight of 386.37 g/mol. Its IUPAC name is methyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate.
| Compound Name | methyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 87340526 |
| Molecular Formula | C14H21F7O2S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | methyl 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)SCCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F7O2S/c1-9(2)8-10(11(22)23-3)24-7-5-4-6-12(15,16)13(17,18)14(19,20)21/h9-10H,4-8H2,1-3H3 |
| InChIKey | SZMDZWIJGQPQTG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|