C14H23F5O2S — CID 87340546
butyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate (PubChem CID 87340546) has the molecular formula C14H23F5O2S and a molecular weight of 350.39 g/mol. Its IUPAC name is butyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate.
| Compound Name | butyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87340546 |
| Molecular Formula | C14H23F5O2S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | butyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
| SMILES | CCCCOC(=O)C(SCCCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H23F5O2S/c1-4-5-8-21-12(20)11(10(2)3)22-9-6-7-13(15,16)14(17,18)19/h10-11H,4-9H2,1-3H3 |
| InChIKey | RQYOYWPEIWGKGY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|