C12H21F3O2S — CID 87340723
3,3-dimethyl-2-(6,6,6-trifluorohexylsulfanyl)butanoic acid (PubChem CID 87340723) has the molecular formula C12H21F3O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-(6,6,6-trifluorohexylsulfanyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(6,6,6-trifluorohexylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 87340723 |
| Molecular Formula | C12H21F3O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3,3-dimethyl-2-(6,6,6-trifluorohexylsulfanyl)butanoic acid |
| SMILES | CC(C)(C)C(SCCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H21F3O2S/c1-11(2,3)9(10(16)17)18-8-6-4-5-7-12(13,14)15/h9H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | LLKMMLKOGKBWEF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|