C13H23F3O2S — CID 87340963
methyl 2-(7,7,7-trifluoroheptylsulfanyl)pentanoate (PubChem CID 87340963) has the molecular formula C13H23F3O2S and a molecular weight of 300.39 g/mol. Its IUPAC name is methyl 2-(7,7,7-trifluoroheptylsulfanyl)pentanoate.
| Compound Name | methyl 2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340963 |
| Molecular Formula | C13H23F3O2S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl 2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
| SMILES | CCCC(SCCCCCCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C13H23F3O2S/c1-3-8-11(12(17)18-2)19-10-7-5-4-6-9-13(14,15)16/h11H,3-10H2,1-2H3 |
| InChIKey | CBROYXPURKSSFG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|