C14H25F3O2S — CID 87341097
butyl 3-methyl-2-(5,5,5-trifluoropentylsulfanyl)butanoate (PubChem CID 87341097) has the molecular formula C14H25F3O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is butyl 3-methyl-2-(5,5,5-trifluoropentylsulfanyl)butanoate.
| Compound Name | butyl 3-methyl-2-(5,5,5-trifluoropentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87341097 |
| Molecular Formula | C14H25F3O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | butyl 3-methyl-2-(5,5,5-trifluoropentylsulfanyl)butanoate |
| SMILES | CCCCOC(=O)C(SCCCCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H25F3O2S/c1-4-5-9-19-13(18)12(11(2)3)20-10-7-6-8-14(15,16)17/h11-12H,4-10H2,1-3H3 |
| InChIKey | VGUJKXUCORALHT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|