C13H17F9O2S — CID 87341269
4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoic acid (PubChem CID 87341269) has the molecular formula C13H17F9O2S and a molecular weight of 408.33 g/mol. Its IUPAC name is 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoic acid.
| Compound Name | 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 87341269 |
| Molecular Formula | C13H17F9O2S |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoic acid |
| SMILES | CC(C)CC(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H17F9O2S/c1-7(2)6-8(9(23)24)25-5-3-4-10(14,15)11(16,17)12(18,19)13(20,21)22/h7-8H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | OTKXBGYPZPBSFE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|