About methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate
methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate (PubChem CID 87341288) has the molecular formula C11H12Cl2N2O2
and a molecular weight of 275.13 g/mol. Its IUPAC name is methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate |
| PubChem CID | 87341288 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(N)c(CC2CC2)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-17-11(16)9-7(12)6(4-5-2-3-5)8(14)10(13)15-9/h5H,2-4,14H2,1H3 |
| InChIKey | KACDAZJQWFGLSU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate?
The IUPAC name of methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate (CID 87341288) is methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate is COC(=O)c1nc(Cl)c(N)c(CC2CC2)c1Cl.
What is the InChIKey of methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate?
The InChIKey is KACDAZJQWFGLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O2/c1-17-11(16)9-7(12)6(4-5-2-3-5)8(14)10(13)15-9/h5H,2-4,14H2,1H3.
What are the key properties of methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate?
methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate has a molecular weight of 275.13 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-3,6-dichloro-4-(cyclopropylmethyl)pyridine-2-carboxylate is sourced from PubChem (CID 87341288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).