2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid

C8H14F2O4S — CID 87341347

IUPAC2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)S(=O)(=O)CCC(F)F
InChIInChI=1S/C8H14F2O4S/c1-5(2)7(8(11)12)15(13,14)4-3-6(9)10/h5-7H,3-4H2,1-2H3,(H,11,12)
InChIKeyWOFDBJSBYJBVOI-UHFFFAOYSA-N
MW244.26 g/mol
LogP1.17
Rot. Bonds6

About 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid

2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid (PubChem CID 87341347) has the molecular formula C8H14F2O4S and a molecular weight of 244.26 g/mol. Its IUPAC name is 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid
PubChem CID87341347
Molecular FormulaC8H14F2O4S
Molecular Weight244.26 g/mol
Exact Mass244.06
IUPAC Name2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)S(=O)(=O)CCC(F)F
InChIInChI=1S/C8H14F2O4S/c1-5(2)7(8(11)12)15(13,14)4-3-6(9)10/h5-7H,3-4H2,1-2H3,(H,11,12)
InChIKeyWOFDBJSBYJBVOI-UHFFFAOYSA-N
XLogP1.17
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.26
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid?
The IUPAC name of 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid (CID 87341347) is 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid?
The canonical SMILES for 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid is CC(C)C(C(=O)O)S(=O)(=O)CCC(F)F.
What is the InChIKey of 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid?
The InChIKey is WOFDBJSBYJBVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2O4S/c1-5(2)7(8(11)12)15(13,14)4-3-6(9)10/h5-7H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid?
2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid has a molecular weight of 244.26 g/mol, XLogP of 1.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropropylsulfonyl)-3-methylbutanoic acid is sourced from PubChem (CID 87341347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).