About 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid
2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid (PubChem CID 87341375) has the molecular formula C12H23FO2S
and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid |
| PubChem CID | 87341375 |
| Molecular Formula | C12H23FO2S |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid |
| SMILES | CCC(F)CCCSC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H23FO2S/c1-5-9(13)7-6-8-16-10(11(14)15)12(2,3)4/h9-10H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | GGQIIWNCMALXEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid (CID 87341375) is 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid is CCC(F)CCCSC(C(=O)O)C(C)(C)C.
What is the InChIKey of 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid?
The InChIKey is GGQIIWNCMALXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FO2S/c1-5-9(13)7-6-8-16-10(11(14)15)12(2,3)4/h9-10H,5-8H2,1-4H3,(H,14,15).
What are the key properties of 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid?
2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid has a molecular weight of 250.38 g/mol, XLogP of 3.75, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorohexylsulfanyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 87341375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).