About 2-(4,4-difluoroheptylsulfanyl)hexanoic acid
2-(4,4-difluoroheptylsulfanyl)hexanoic acid (PubChem CID 87341394) has the molecular formula C13H24F2O2S
and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-(4,4-difluoroheptylsulfanyl)hexanoic acid.
Molecular Properties
| Compound Name | 2-(4,4-difluoroheptylsulfanyl)hexanoic acid |
| PubChem CID | 87341394 |
| Molecular Formula | C13H24F2O2S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(4,4-difluoroheptylsulfanyl)hexanoic acid |
| SMILES | CCCCC(SCCCC(F)(F)CCC)C(=O)O |
| InChI | InChI=1S/C13H24F2O2S/c1-3-5-7-11(12(16)17)18-10-6-9-13(14,15)8-4-2/h11H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | BOBSFRVUXDDBFL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluoroheptylsulfanyl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoroheptylsulfanyl)hexanoic acid?
The IUPAC name of 2-(4,4-difluoroheptylsulfanyl)hexanoic acid (CID 87341394) is 2-(4,4-difluoroheptylsulfanyl)hexanoic acid.
What is the SMILES notation for 2-(4,4-difluoroheptylsulfanyl)hexanoic acid?
The canonical SMILES for 2-(4,4-difluoroheptylsulfanyl)hexanoic acid is CCCCC(SCCCC(F)(F)CCC)C(=O)O.
What is the InChIKey of 2-(4,4-difluoroheptylsulfanyl)hexanoic acid?
The InChIKey is BOBSFRVUXDDBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2O2S/c1-3-5-7-11(12(16)17)18-10-6-9-13(14,15)8-4-2/h11H,3-10H2,1-2H3,(H,16,17).
What are the key properties of 2-(4,4-difluoroheptylsulfanyl)hexanoic acid?
2-(4,4-difluoroheptylsulfanyl)hexanoic acid has a molecular weight of 282.40 g/mol, XLogP of 4.58, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoroheptylsulfanyl)hexanoic acid is sourced from PubChem (CID 87341394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).