2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid

C9H16F2O4S — CID 87341557

IUPAC2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)S(=O)(=O)CCC(F)F
InChIInChI=1S/C9H16F2O4S/c1-6(2)5-7(9(12)13)16(14,15)4-3-8(10)11/h6-8H,3-5H2,1-2H3,(H,12,13)
InChIKeyAJZCIQQBEVCCDO-UHFFFAOYSA-N
MW258.29 g/mol
LogP1.56
Rot. Bonds7

About 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid

2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid (PubChem CID 87341557) has the molecular formula C9H16F2O4S and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid
PubChem CID87341557
Molecular FormulaC9H16F2O4S
Molecular Weight258.29 g/mol
Exact Mass258.07
IUPAC Name2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)S(=O)(=O)CCC(F)F
InChIInChI=1S/C9H16F2O4S/c1-6(2)5-7(9(12)13)16(14,15)4-3-8(10)11/h6-8H,3-5H2,1-2H3,(H,12,13)
InChIKeyAJZCIQQBEVCCDO-UHFFFAOYSA-N
XLogP1.56
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.29
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid?
The IUPAC name of 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid (CID 87341557) is 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid.
What is the SMILES notation for 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid?
The canonical SMILES for 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid is CC(C)CC(C(=O)O)S(=O)(=O)CCC(F)F.
What is the InChIKey of 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid?
The InChIKey is AJZCIQQBEVCCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2O4S/c1-6(2)5-7(9(12)13)16(14,15)4-3-8(10)11/h6-8H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid?
2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid has a molecular weight of 258.29 g/mol, XLogP of 1.56, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropropylsulfonyl)-4-methylpentanoic acid is sourced from PubChem (CID 87341557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).