C9H15F3O4S — CID 87341580
3,3-dimethyl-2-(3,3,3-trifluoropropylsulfonyl)butanoic acid (PubChem CID 87341580) has the molecular formula C9H15F3O4S and a molecular weight of 276.28 g/mol. Its IUPAC name is 3,3-dimethyl-2-(3,3,3-trifluoropropylsulfonyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(3,3,3-trifluoropropylsulfonyl)butanoic acid |
|---|---|
| PubChem CID | 87341580 |
| Molecular Formula | C9H15F3O4S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3,3-dimethyl-2-(3,3,3-trifluoropropylsulfonyl)butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O4S/c1-8(2,3)6(7(13)14)17(15,16)5-4-9(10,11)12/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | BVZNKLUMXJYJPN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |