About 2-(3,3-difluoropropylsulfinyl)acetonitrile
2-(3,3-difluoropropylsulfinyl)acetonitrile (PubChem CID 87341675) has the molecular formula C5H7F2NOS
and a molecular weight of 167.18 g/mol. Its IUPAC name is 2-(3,3-difluoropropylsulfinyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3,3-difluoropropylsulfinyl)acetonitrile |
| PubChem CID | 87341675 |
| Molecular Formula | C5H7F2NOS |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 2-(3,3-difluoropropylsulfinyl)acetonitrile |
| SMILES | N#CCS(=O)CCC(F)F |
| InChI | InChI=1S/C5H7F2NOS/c6-5(7)1-3-10(9)4-2-8/h5H,1,3-4H2 |
| InChIKey | QLVSYLJPKMOBFN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-difluoropropylsulfinyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropropylsulfinyl)acetonitrile?
The IUPAC name of 2-(3,3-difluoropropylsulfinyl)acetonitrile (CID 87341675) is 2-(3,3-difluoropropylsulfinyl)acetonitrile.
What is the SMILES notation for 2-(3,3-difluoropropylsulfinyl)acetonitrile?
The canonical SMILES for 2-(3,3-difluoropropylsulfinyl)acetonitrile is N#CCS(=O)CCC(F)F.
What is the InChIKey of 2-(3,3-difluoropropylsulfinyl)acetonitrile?
The InChIKey is QLVSYLJPKMOBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2NOS/c6-5(7)1-3-10(9)4-2-8/h5H,1,3-4H2.
What are the key properties of 2-(3,3-difluoropropylsulfinyl)acetonitrile?
2-(3,3-difluoropropylsulfinyl)acetonitrile has a molecular weight of 167.18 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropropylsulfinyl)acetonitrile is sourced from PubChem (CID 87341675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).