C12H19F5O2S — CID 87341760
ethyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate (PubChem CID 87341760) has the molecular formula C12H19F5O2S and a molecular weight of 322.34 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate.
| Compound Name | ethyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87341760 |
| Molecular Formula | C12H19F5O2S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | ethyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(SCCCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H19F5O2S/c1-4-19-10(18)9(8(2)3)20-7-5-6-11(13,14)12(15,16)17/h8-9H,4-7H2,1-3H3 |
| InChIKey | ONDODQRTNBAACC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|