About 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine
2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine (PubChem CID 87341802) has the molecular formula C10H21NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine.
Molecular Properties
| Compound Name | 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine |
| PubChem CID | 87341802 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine |
| SMILES | [2H]C1([2H])CCC(C(C)(OCC)OCC)N1 |
| InChI | InChI=1S/C10H21NO2/c1-4-12-10(3,13-5-2)9-7-6-8-11-9/h9,11H,4-8H2,1-3H3/i8D2 |
| InChIKey | JSKKDCMRNWEHKK-MGVXTIMCSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine?
The IUPAC name of 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine (CID 87341802) is 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine.
What is the SMILES notation for 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine?
The canonical SMILES for 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine is [2H]C1([2H])CCC(C(C)(OCC)OCC)N1.
What is the InChIKey of 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine?
The InChIKey is JSKKDCMRNWEHKK-MGVXTIMCSA-N. The full InChI is InChI=1S/C10H21NO2/c1-4-12-10(3,13-5-2)9-7-6-8-11-9/h9,11H,4-8H2,1-3H3/i8D2.
What are the key properties of 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine?
2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine has a molecular weight of 189.30 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dideuterio-5-(1,1-diethoxyethyl)pyrrolidine is sourced from PubChem (CID 87341802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).