C13H22F4O2S — CID 87342269
propyl 3-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)butanoate (PubChem CID 87342269) has the molecular formula C13H22F4O2S and a molecular weight of 318.38 g/mol. Its IUPAC name is propyl 3-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)butanoate.
| Compound Name | propyl 3-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87342269 |
| Molecular Formula | C13H22F4O2S |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | propyl 3-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)butanoate |
| SMILES | CCCOC(=O)C(SCCCC(F)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C13H22F4O2S/c1-4-7-19-11(18)10(9(2)3)20-8-5-6-13(16,17)12(14)15/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | MSYYRJOTMMWBTN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|