C29H35F21O2 — CID 87342427
7,7,7-trifluoro-2-[1,1,1,7,7,7-hexafluoro-4-(3,3,3-trifluoropropyl)heptan-4-yl]-3-(6,6,6-trifluorohexan-3-yl)-4,4-bis(3,3,3-trifluoropropyl)hept-2-enoic acid (PubChem CID 87342427) has the molecular formula C29H35F21O2 and a molecular weight of 814.55 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-[1,1,1,7,7,7-hexafluoro-4-(3,3,3-trifluoropropyl)heptan-4-yl]-3-(6,6,6-trifluorohexan-3-yl)-4,4-bis(3,3,3-trifluoropropyl)hept-2-enoic acid.
| Compound Name | 7,7,7-trifluoro-2-[1,1,1,7,7,7-hexafluoro-4-(3,3,3-trifluoropropyl)heptan-4-yl]-3-(6,6,6-trifluorohexan-3-yl)-4,4-bis(3,3,3-trifluoropropyl)hept-2-enoic acid |
|---|---|
| PubChem CID | 87342427 |
| Molecular Formula | C29H35F21O2 |
| Molecular Weight | 814.55 g/mol |
| Exact Mass | 814.23 |
| IUPAC Name | 7,7,7-trifluoro-2-[1,1,1,7,7,7-hexafluoro-4-(3,3,3-trifluoropropyl)heptan-4-yl]-3-(6,6,6-trifluorohexan-3-yl)-4,4-bis(3,3,3-trifluoropropyl)hept-2-enoic acid |
| SMILES | CCC(CCC(F)(F)F)C(=C(C(=O)O)C(CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)F)C(CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C29H35F21O2/c1-2-17(3-4-23(30,31)32)18(21(5-11-24(33,34)35,6-12-25(36,37)38)7-13-26(39,40)41)19(20(51)52)22(8-14-27(42,43)44,9-15-28(45,46)47)10-16-29(48,49)50/h17H,2-16H2,1H3,(H,51,52) |
| InChIKey | CCQBPQHECKXGEJ-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.55 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|