C18H10F14N2O2 — CID 87342938
4-[4-amino-2-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-3-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline (PubChem CID 87342938) has the molecular formula C18H10F14N2O2 and a molecular weight of 552.26 g/mol. Its IUPAC name is 4-[4-amino-2-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-3-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline.
| Compound Name | 4-[4-amino-2-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-3-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline |
|---|---|
| PubChem CID | 87342938 |
| Molecular Formula | C18H10F14N2O2 |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 4-[4-amino-2-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-3-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline |
| SMILES | Nc1ccc(-c2ccc(N)cc2OC(F)(F)C(F)(F)C(F)(F)F)c(OC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F14N2O2/c19-13(20,15(23,24)25)17(29,30)35-11-5-7(33)1-3-9(11)10-4-2-8(34)6-12(10)36-18(31,32)14(21,22)16(26,27)28/h1-6H,33-34H2 |
| InChIKey | IZESZTIJRAGAQY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|