About 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium
1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium (PubChem CID 87342975) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium.
Molecular Properties
| Compound Name | 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium |
| PubChem CID | 87342975 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium |
| SMILES | [CH2-][NH+]1C=C(C)N=C1C |
| InChI | InChI=1S/C6H10N2/c1-5-4-8(3)6(2)7-5/h4,8H,3H2,1-2H3 |
| InChIKey | ANZTWVWWPPEUJS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium?
The IUPAC name of 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium (CID 87342975) is 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium.
What is the SMILES notation for 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium?
The canonical SMILES for 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium is [CH2-][NH+]1C=C(C)N=C1C.
What is the InChIKey of 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium?
The InChIKey is ANZTWVWWPPEUJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-4-8(3)6(2)7-5/h4,8H,3H2,1-2H3.
What are the key properties of 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium?
1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium has a molecular weight of 110.16 g/mol, XLogP of -0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-2,4-dimethyl-1H-imidazol-1-ium is sourced from PubChem (CID 87342975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).