C23H26F4N2O4 — CID 87343004
N-[7-(hydroxyamino)-7-oxoheptyl]-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-methoxyethyl]benzamide (PubChem CID 87343004) has the molecular formula C23H26F4N2O4 and a molecular weight of 470.46 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-methoxyethyl]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-methoxyethyl]benzamide |
|---|---|
| PubChem CID | 87343004 |
| Molecular Formula | C23H26F4N2O4 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-methoxyethyl]benzamide |
| SMILES | COC(c1ccc(F)cc1)(c1ccc(C(=O)NCCCCCCC(=O)NO)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H26F4N2O4/c1-33-22(23(25,26)27,18-11-13-19(24)14-12-18)17-9-7-16(8-10-17)21(31)28-15-5-3-2-4-6-20(30)29-32/h7-14,32H,2-6,15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | BMKKVAXKPSWHHO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|