C25H30ClN9O3 — CID 87343272
3,5-diamino-6-chloro-N-[8-[4-(3-phenyl-2,3-dihydro-1,2-oxazol-5-yl)butanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide (PubChem CID 87343272) has the molecular formula C25H30ClN9O3 and a molecular weight of 540.03 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[8-[4-(3-phenyl-2,3-dihydro-1,2-oxazol-5-yl)butanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[8-[4-(3-phenyl-2,3-dihydro-1,2-oxazol-5-yl)butanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87343272 |
| Molecular Formula | C25H30ClN9O3 |
| Molecular Weight | 540.03 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[8-[4-(3-phenyl-2,3-dihydro-1,2-oxazol-5-yl)butanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)NC2=NCC3(CCN(C(=O)CCCC4=CC(c5ccccc5)NO4)CC3)N2)nc1Cl |
| InChI | InChI=1S/C25H30ClN9O3/c26-20-22(28)31-21(27)19(30-20)23(37)32-24-29-14-25(33-24)9-11-35(12-10-25)18(36)8-4-7-16-13-17(34-38-16)15-5-2-1-3-6-15/h1-3,5-6,13,17,34H,4,7-12,14H2,(H4,27,28,31)(H2,29,32,33,37) |
| InChIKey | ACYNIYXITNUCIR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.03 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |