C42H46FeN2P2-6 — CID 87343500
cyclopentane;ditert-butyl-[[5-(dipyridin-2-ylphosphanylmethyl)-2,3-diphenylcyclopenta-2,4-dien-1-yl]methyl]phosphane;iron (PubChem CID 87343500) has the molecular formula C42H46FeN2P2-6 and a molecular weight of 696.64 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-[[5-(dipyridin-2-ylphosphanylmethyl)-2,3-diphenylcyclopenta-2,4-dien-1-yl]methyl]phosphane;iron.
| Compound Name | cyclopentane;ditert-butyl-[[5-(dipyridin-2-ylphosphanylmethyl)-2,3-diphenylcyclopenta-2,4-dien-1-yl]methyl]phosphane;iron |
|---|---|
| PubChem CID | 87343500 |
| Molecular Formula | C42H46FeN2P2-6 |
| Molecular Weight | 696.64 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | cyclopentane;ditert-butyl-[[5-(dipyridin-2-ylphosphanylmethyl)-2,3-diphenylcyclopenta-2,4-dien-1-yl]methyl]phosphane;iron |
| SMILES | CC(C)(C)P(C[c-]1c(CP(c2ccccn2)c2ccccn2)cc(-c2ccccc2)c1-c1ccccc1)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C37H41N2P2.C5H5.Fe/c1-36(2,3)41(37(4,5)6)27-32-30(26-40(33-21-13-15-23-38-33)34-22-14-16-24-39-34)25-31(28-17-9-7-10-18-28)35(32)29-19-11-8-12-20-29;1-2-4-5-3-1;/h7-25H,26-27H2,1-6H3;1-5H;/q-1;-5; |
| InChIKey | CACFAHATNBZKIG-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.64 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|