C12H19F3N2O3 — CID 87343540
(3S)-N-cyclopentylpyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate (PubChem CID 87343540) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is (3S)-N-cyclopentylpyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | (3S)-N-cyclopentylpyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87343540 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3S)-N-cyclopentylpyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate |
| SMILES | O=C(NC1CCCC1)[C@H]1CC[NH2+]C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H18N2O.C2HF3O2/c13-10(8-5-6-11-7-8)12-9-3-1-2-4-9;3-2(4,5)1(6)7/h8-9,11H,1-7H2,(H,12,13);(H,6,7)/t8-;/m0./s1 |
| InChIKey | IHVVGBGWHAOTJS-QRPNPIFTSA-N |
| XLogP | -1.07 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |