About N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine
N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine (PubChem CID 87343596) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine |
| PubChem CID | 87343596 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.CCN(C)C |
| InChI | InChI=1S/C6H15N.C4H11N/c1-5(2)7-6(3)4;1-4-5(2)3/h5-7H,1-4H3;4H2,1-3H3 |
| InChIKey | PZVNVBLQNOXFPD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine?
The IUPAC name of N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine (CID 87343596) is N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine?
The canonical SMILES for N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.CCN(C)C.
What is the InChIKey of N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine?
The InChIKey is PZVNVBLQNOXFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H11N/c1-5(2)7-6(3)4;1-4-5(2)3/h5-7H,1-4H3;4H2,1-3H3.
What are the key properties of N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine?
N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine has a molecular weight of 174.33 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 87343596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).