C21H19FN4O2 — CID 87343705
3-fluoro-4-[3-[(E)-hydroxyiminomethyl]-2-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]phenol (PubChem CID 87343705) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-fluoro-4-[3-[(E)-hydroxyiminomethyl]-2-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]phenol.
| Compound Name | 3-fluoro-4-[3-[(E)-hydroxyiminomethyl]-2-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]phenol |
|---|---|
| PubChem CID | 87343705 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-fluoro-4-[3-[(E)-hydroxyiminomethyl]-2-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]phenol |
| SMILES | Cc1nn(C)c(C)c1-c1c(/C=N/O)c2ccccc2n1-c1ccc(O)cc1F |
| InChI | InChI=1S/C21H19FN4O2/c1-12-20(13(2)25(3)24-12)21-16(11-23-28)15-6-4-5-7-18(15)26(21)19-9-8-14(27)10-17(19)22/h4-11,27-28H,1-3H3/b23-11+ |
| InChIKey | PJBAHBWIOBPQHI-FOKLQQMPSA-N |
| XLogP | 4.30 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|