C35H54ClFN6O4Si2 — CID 87343744
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-5-fluoro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 87343744) has the molecular formula C35H54ClFN6O4Si2 and a molecular weight of 733.48 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-5-fluoro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-5-fluoro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 87343744 |
| Molecular Formula | C35H54ClFN6O4Si2 |
| Molecular Weight | 733.48 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-5-fluoro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc(Cl)c(F)c4)c3n1)C2 |
| InChI | InChI=1S/C35H54ClFN6O4Si2/c1-35(2,3)47-34(44)42-26-10-11-27(42)17-24(16-26)30-19-31(41(22-45-12-14-48(4,5)6)23-46-13-15-49(7,8)9)43-33(40-30)28(21-39-43)25-18-29(37)32(36)38-20-25/h18-21,24,26-27H,10-17,22-23H2,1-9H3 |
| InChIKey | NTOHTLXAGQGIKP-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.48 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|