C72H62BN7 — CID 87344470
3-methyl-2-(4-naphthalen-2-ylphenyl)imidazo[4,5-f][1,10]phenanthroline;tris(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane (PubChem CID 87344470) has the molecular formula C72H62BN7 and a molecular weight of 1036.15 g/mol. Its IUPAC name is 3-methyl-2-(4-naphthalen-2-ylphenyl)imidazo[4,5-f][1,10]phenanthroline;tris(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane.
| Compound Name | 3-methyl-2-(4-naphthalen-2-ylphenyl)imidazo[4,5-f][1,10]phenanthroline;tris(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane |
|---|---|
| PubChem CID | 87344470 |
| Molecular Formula | C72H62BN7 |
| Molecular Weight | 1036.15 g/mol |
| Exact Mass | 1035.52 |
| IUPAC Name | 3-methyl-2-(4-naphthalen-2-ylphenyl)imidazo[4,5-f][1,10]phenanthroline;tris(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane |
| SMILES | Cc1cc(C)c(-c2cccnc2)c(C)c1B(c1c(C)cc(C)c(-c2cccnc2)c1C)c1c(C)cc(C)c(-c2cccnc2)c1C.Cn1c(-c2ccc(-c3ccc4ccccc4c3)cc2)nc2c3cccnc3c3ncccc3c21 |
| InChI | InChI=1S/C42H42BN3.C30H20N4/c1-25-19-28(4)40(31(7)37(25)34-13-10-16-44-22-34)43(41-29(5)20-26(2)38(32(41)8)35-14-11-17-45-23-35)42-30(6)21-27(3)39(33(42)9)36-15-12-18-46-24-36;1-34-29-25-9-5-17-32-27(25)26-24(8-4-16-31-26)28(29)33-30(34)21-13-10-20(11-14-21)23-15-12-19-6-2-3-7-22(19)18-23/h10-24H,1-9H3;2-18H,1H3 |
| InChIKey | IQCFBUCSXFPJFP-UHFFFAOYSA-N |
| XLogP | 15.32 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.15 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|