About sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate
sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate (PubChem CID 87344827) has the molecular formula C6H4NNaO9S
and a molecular weight of 289.15 g/mol. Its IUPAC name is sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate.
Molecular Properties
| Compound Name | sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate |
| PubChem CID | 87344827 |
| Molecular Formula | C6H4NNaO9S |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate |
| SMILES | O=C([O-])C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na+] |
| InChI | InChI=1S/C6H5NO9S.Na/c8-3-1-2(17(13,14)15)4(9)7(3)16-6(12)5(10)11;/h2H,1H2,(H,10,11)(H,13,14,15);/q;+1/p-1 |
| InChIKey | ZEIRINOODCKUJD-UHFFFAOYSA-M |
| XLogP | -6.79 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | -6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate?
The IUPAC name of sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate (CID 87344827) is sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate.
What is the SMILES notation for sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate?
The canonical SMILES for sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate is O=C([O-])C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na+].
What is the InChIKey of sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate?
The InChIKey is ZEIRINOODCKUJD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO9S.Na/c8-3-1-2(17(13,14)15)4(9)7(3)16-6(12)5(10)11;/h2H,1H2,(H,10,11)(H,13,14,15);/q;+1/p-1.
What are the key properties of sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate?
sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate has a molecular weight of 289.15 g/mol, XLogP of -6.79, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-2-oxoacetate is sourced from PubChem (CID 87344827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).