C7H9F6NO2 — CID 87344915
(3S,4S)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrrolidin-3-ol (PubChem CID 87344915) has the molecular formula C7H9F6NO2 and a molecular weight of 253.14 g/mol. Its IUPAC name is (3S,4S)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 87344915 |
| Molecular Formula | C7H9F6NO2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (3S,4S)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrrolidin-3-ol |
| SMILES | O[C@H]1CNC[C@@H]1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F6NO2/c8-6(9,10)5(7(11,12)13)16-4-2-14-1-3(4)15/h3-5,14-15H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | JYMGKVIVRXELQI-IMJSIDKUSA-N |
| XLogP | 0.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |