About 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride
1-cyclohexylcyclohexane-1,2-dicarbonyl chloride (PubChem CID 87344968) has the molecular formula C14H20Cl2O2
and a molecular weight of 291.22 g/mol. Its IUPAC name is 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride.
Molecular Properties
| Compound Name | 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride |
| PubChem CID | 87344968 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride |
| SMILES | O=C(Cl)C1CCCCC1(C(=O)Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H20Cl2O2/c15-12(17)11-8-4-5-9-14(11,13(16)18)10-6-2-1-3-7-10/h10-11H,1-9H2 |
| InChIKey | FOILAIFDEZCGIP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride?
The IUPAC name of 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride (CID 87344968) is 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride.
What is the SMILES notation for 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride?
The canonical SMILES for 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride is O=C(Cl)C1CCCCC1(C(=O)Cl)C1CCCCC1.
What is the InChIKey of 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride?
The InChIKey is FOILAIFDEZCGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2O2/c15-12(17)11-8-4-5-9-14(11,13(16)18)10-6-2-1-3-7-10/h10-11H,1-9H2.
What are the key properties of 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride?
1-cyclohexylcyclohexane-1,2-dicarbonyl chloride has a molecular weight of 291.22 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylcyclohexane-1,2-dicarbonyl chloride is sourced from PubChem (CID 87344968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).