C28H35BF3N3O4 — CID 87345474
(2S)-2-[cyanomethyl-[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[4-(trifluoromethoxy)phenyl]methyl]amino]-4-methylpentanamide (PubChem CID 87345474) has the molecular formula C28H35BF3N3O4 and a molecular weight of 545.41 g/mol. Its IUPAC name is (2S)-2-[cyanomethyl-[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[4-(trifluoromethoxy)phenyl]methyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[cyanomethyl-[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[4-(trifluoromethoxy)phenyl]methyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87345474 |
| Molecular Formula | C28H35BF3N3O4 |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | (2S)-2-[cyanomethyl-[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[4-(trifluoromethoxy)phenyl]methyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(CC#N)[C@H](c1ccc(OC(F)(F)F)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C28H35BF3N3O4/c1-18(2)17-23(25(34)36)35(16-15-33)24(20-9-13-22(14-10-20)37-28(30,31)32)19-7-11-21(12-8-19)29-38-26(3,4)27(5,6)39-29/h7-14,18,23-24H,16-17H2,1-6H3,(H2,34,36)/t23-,24-/m0/s1 |
| InChIKey | LMUZWNSATRBZSZ-ZEQRLZLVSA-N |
| XLogP | 4.70 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|