C13H17F3N4OS — CID 87345784
(2S)-N-(cyanomethyl)-4-methyl-2-[[(1R)-2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]amino]pentanamide (PubChem CID 87345784) has the molecular formula C13H17F3N4OS and a molecular weight of 334.37 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[(1R)-2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1R)-2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 87345784 |
| Molecular Formula | C13H17F3N4OS |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1R)-2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1nccs1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C13H17F3N4OS/c1-8(2)7-9(11(21)18-4-3-17)20-10(13(14,15)16)12-19-5-6-22-12/h5-6,8-10,20H,4,7H2,1-2H3,(H,18,21)/t9-,10-/m0/s1 |
| InChIKey | RTTXZUBBSYPUJE-UWVGGRQHSA-N |
| XLogP | 2.39 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|