C25H25F3N4O — CID 87345832
(2S)-2-[cyanomethyl-[2,2,2-trifluoro-1-(4-quinolin-8-ylphenyl)ethyl]amino]-4-methylpentanamide (PubChem CID 87345832) has the molecular formula C25H25F3N4O and a molecular weight of 454.50 g/mol. Its IUPAC name is (2S)-2-[cyanomethyl-[2,2,2-trifluoro-1-(4-quinolin-8-ylphenyl)ethyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[cyanomethyl-[2,2,2-trifluoro-1-(4-quinolin-8-ylphenyl)ethyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87345832 |
| Molecular Formula | C25H25F3N4O |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2S)-2-[cyanomethyl-[2,2,2-trifluoro-1-(4-quinolin-8-ylphenyl)ethyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(CC#N)C(c1ccc(-c2cccc3cccnc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H25F3N4O/c1-16(2)15-21(24(30)33)32(14-12-29)23(25(26,27)28)19-10-8-17(9-11-19)20-7-3-5-18-6-4-13-31-22(18)20/h3-11,13,16,21,23H,14-15H2,1-2H3,(H2,30,33)/t21-,23?/m0/s1 |
| InChIKey | RTNFFRFPDJKIOB-BBQAJUCSSA-N |
| XLogP | 5.23 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|