C12H8F8N4 — CID 87346449
3-fluoro-4-[[5-(1,1,2,2-tetrafluoroethyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]aniline (PubChem CID 87346449) has the molecular formula C12H8F8N4 and a molecular weight of 360.21 g/mol. Its IUPAC name is 3-fluoro-4-[[5-(1,1,2,2-tetrafluoroethyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]aniline.
| Compound Name | 3-fluoro-4-[[5-(1,1,2,2-tetrafluoroethyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 87346449 |
| Molecular Formula | C12H8F8N4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-fluoro-4-[[5-(1,1,2,2-tetrafluoroethyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]aniline |
| SMILES | Nc1ccc(Cn2nc(C(F)(F)F)nc2C(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C12H8F8N4/c13-7-3-6(21)2-1-5(7)4-24-10(11(16,17)8(14)15)22-9(23-24)12(18,19)20/h1-3,8H,4,21H2 |
| InChIKey | GVETWWIPPAFGPF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|