About formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate
formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate (PubChem CID 87347032) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate |
| PubChem CID | 87347032 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate |
| SMILES | C=C(CC1COC(C)(CC)O1)C(=O)ONC=O |
| InChI | InChI=1S/C11H17NO5/c1-4-11(3)15-6-9(16-11)5-8(2)10(14)17-12-7-13/h7,9H,2,4-6H2,1,3H3,(H,12,13) |
| InChIKey | WKZZJKVJCUALSX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate?
The IUPAC name of formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate (CID 87347032) is formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate.
What is the SMILES notation for formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate?
The canonical SMILES for formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate is C=C(CC1COC(C)(CC)O1)C(=O)ONC=O.
What is the InChIKey of formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate?
The InChIKey is WKZZJKVJCUALSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c1-4-11(3)15-6-9(16-11)5-8(2)10(14)17-12-7-13/h7,9H,2,4-6H2,1,3H3,(H,12,13).
What are the key properties of formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate?
formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate has a molecular weight of 243.26 g/mol, XLogP of 0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formamido 2-[(2-ethyl-2-methyl-1,3-dioxolan-4-yl)methyl]prop-2-enoate is sourced from PubChem (CID 87347032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).