C32H53F3O5SSi2 — CID 87347152
[(1S,3R,10R,13S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 87347152) has the molecular formula C32H53F3O5SSi2 and a molecular weight of 663.00 g/mol. Its IUPAC name is [(1S,3R,10R,13S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,3R,10R,13S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87347152 |
| Molecular Formula | C32H53F3O5SSi2 |
| Molecular Weight | 663.00 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | [(1S,3R,10R,13S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC2=CC=C3C(CC[C@]4(C)C(OS(=O)(=O)C(F)(F)F)=CCC34)[C@@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H53F3O5SSi2/c1-28(2,3)42(9,10)39-22-19-21-13-14-23-24-15-16-26(38-41(36,37)32(33,34)35)30(24,7)18-17-25(23)31(21,8)27(20-22)40-43(11,12)29(4,5)6/h13-14,16,22,24-25,27H,15,17-20H2,1-12H3/t22-,24?,25?,27+,30+,31+/m1/s1 |
| InChIKey | ZPLSJRLTMNEJSQ-UIWGVXOZSA-N |
| XLogP | 9.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.00 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|