C13H11N3 — CID 87347317
3,5-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-4-amine (PubChem CID 87347317) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-4-amine.
| Compound Name | 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-4-amine |
|---|---|
| PubChem CID | 87347317 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-4-amine |
| SMILES | NC1=NC=C2C=CC=c3ccccc3=C2N1 |
| InChI | InChI=1S/C13H11N3/c14-13-15-8-10-6-3-5-9-4-1-2-7-11(9)12(10)16-13/h1-8H,(H3,14,15,16) |
| InChIKey | SZMICDXESXAAMG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |