C16H12F8O8S — CID 87347441
ethane-1,2-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid;2,4,5-trifluoro-3-methoxybenzoic acid (PubChem CID 87347441) has the molecular formula C16H12F8O8S and a molecular weight of 516.32 g/mol. Its IUPAC name is ethane-1,2-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid;2,4,5-trifluoro-3-methoxybenzoic acid.
| Compound Name | ethane-1,2-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid;2,4,5-trifluoro-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 87347441 |
| Molecular Formula | C16H12F8O8S |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | ethane-1,2-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid;2,4,5-trifluoro-3-methoxybenzoic acid |
| SMILES | COc1c(F)c(F)cc(C(=O)O)c1F.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F.OCCO |
| InChI | InChI=1S/C8H5F3O3.C6HF5O3S.C2H6O2/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9;3-1-2-4/h2H,1H3,(H,12,13);(H,12,13,14);3-4H,1-2H2 |
| InChIKey | APNJWOYXTOHTEQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|