C11H13F5O7S — CID 87347801
methanesulfonic acid;2,3,4,5,6-pentafluorobenzoic acid;propane-1,2-diol (PubChem CID 87347801) has the molecular formula C11H13F5O7S and a molecular weight of 384.28 g/mol. Its IUPAC name is methanesulfonic acid;2,3,4,5,6-pentafluorobenzoic acid;propane-1,2-diol.
| Compound Name | methanesulfonic acid;2,3,4,5,6-pentafluorobenzoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 87347801 |
| Molecular Formula | C11H13F5O7S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | methanesulfonic acid;2,3,4,5,6-pentafluorobenzoic acid;propane-1,2-diol |
| SMILES | CC(O)CO.CS(=O)(=O)O.O=C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7HF5O2.C3H8O2.CH4O3S/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;1-3(5)2-4;1-5(2,3)4/h(H,13,14);3-5H,2H2,1H3;1H3,(H,2,3,4) |
| InChIKey | WHHPARKFUZIBCU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|