About benzene;hydrogen sulfite;zirconium(2+)
benzene;hydrogen sulfite;zirconium(2+) (PubChem CID 87348464) has the molecular formula C6H6O3SZr
and a molecular weight of 249.40 g/mol. Its IUPAC name is benzene;hydrogen sulfite;zirconium(2+).
Molecular Properties
| Compound Name | benzene;hydrogen sulfite;zirconium(2+) |
| PubChem CID | 87348464 |
| Molecular Formula | C6H6O3SZr |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 247.91 |
| IUPAC Name | benzene;hydrogen sulfite;zirconium(2+) |
| SMILES | O=S([O-])O.[Zr+2].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.H2O3S.Zr/c1-2-4-6-5-3-1;1-4(2)3;/h1-5H;(H2,1,2,3);/q-1;;+2/p-1 |
| InChIKey | KDXRPLQHGVKOTP-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze benzene;hydrogen sulfite;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;hydrogen sulfite;zirconium(2+)?
The IUPAC name of benzene;hydrogen sulfite;zirconium(2+) (CID 87348464) is benzene;hydrogen sulfite;zirconium(2+).
What is the SMILES notation for benzene;hydrogen sulfite;zirconium(2+)?
The canonical SMILES for benzene;hydrogen sulfite;zirconium(2+) is O=S([O-])O.[Zr+2].[c-]1ccccc1.
What is the InChIKey of benzene;hydrogen sulfite;zirconium(2+)?
The InChIKey is KDXRPLQHGVKOTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.H2O3S.Zr/c1-2-4-6-5-3-1;1-4(2)3;/h1-5H;(H2,1,2,3);/q-1;;+2/p-1.
What are the key properties of benzene;hydrogen sulfite;zirconium(2+)?
benzene;hydrogen sulfite;zirconium(2+) has a molecular weight of 249.40 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;hydrogen sulfite;zirconium(2+) is sourced from PubChem (CID 87348464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).