C22H30FN3O3 — CID 87348601
(2S,3S,5R)-5-fluoro-N-hydroxy-1-methyl-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 87348601) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is (2S,3S,5R)-5-fluoro-N-hydroxy-1-methyl-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5R)-5-fluoro-N-hydroxy-1-methyl-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87348601 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (2S,3S,5R)-5-fluoro-N-hydroxy-1-methyl-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1cccc(C2=CCN(C(=O)[C@@H]3[C@@H](C(=O)NO)C[C@@H](F)CN3C)CC2)c1 |
| InChI | InChI=1S/C22H30FN3O3/c1-14(2)16-5-4-6-17(11-16)15-7-9-26(10-8-15)22(28)20-19(21(27)24-29)12-18(23)13-25(20)3/h4-7,11,14,18-20,29H,8-10,12-13H2,1-3H3,(H,24,27)/t18-,19+,20+/m1/s1 |
| InChIKey | DDLLVZPKWIIWFV-AABGKKOBSA-N |
| XLogP | 2.59 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|