C23H31N3O6 — CID 87348770
(3R,4S)-3-(hydroxycarbamoyl)-2-(oxan-4-yl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylic acid (PubChem CID 87348770) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (3R,4S)-3-(hydroxycarbamoyl)-2-(oxan-4-yl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylic acid.
| Compound Name | (3R,4S)-3-(hydroxycarbamoyl)-2-(oxan-4-yl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87348770 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (3R,4S)-3-(hydroxycarbamoyl)-2-(oxan-4-yl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylic acid |
| SMILES | O=C(NO)[C@H]1C(C2CCOCC2)N(C(=O)O)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H31N3O6/c27-21(24-31)19-18(7-11-26(23(29)30)20(19)16-8-12-32-13-9-16)22(28)25-10-6-17(14-25)15-4-2-1-3-5-15/h1-5,16-20,31H,6-14H2,(H,24,27)(H,29,30)/t17-,18-,19+,20?/m0/s1 |
| InChIKey | LAQPSAXSGSACKO-GURQWTFNSA-N |
| XLogP | 1.92 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|