C25H33F3N4O7 — CID 87348772
[(1R,3S,4S)-3-(hydroxycarbamoyl)-1-methyl-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] azetidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 87348772) has the molecular formula C25H33F3N4O7 and a molecular weight of 558.55 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(hydroxycarbamoyl)-1-methyl-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] azetidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-1-methyl-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] azetidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87348772 |
| Molecular Formula | C25H33F3N4O7 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-1-methyl-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] azetidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@]1(OC(=O)N2CCC2)CC[C@H](C(=O)N2CCN(c3ccccc3)CC2)[C@@H](C(=O)NO)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H32N4O5.C2HF3O2/c1-23(32-22(30)27-10-5-11-27)9-8-18(19(16-23)20(28)24-31)21(29)26-14-12-25(13-15-26)17-6-3-2-4-7-17;3-2(4,5)1(6)7/h2-4,6-7,18-19,31H,5,8-16H2,1H3,(H,24,28);(H,6,7)/t18-,19-,23+;/m0./s1 |
| InChIKey | ANRYBAAPZSAHQH-IUFMKLONSA-N |
| XLogP | 2.49 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|