C25H35N3O6 — CID 87349220
[(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]methyl-(oxan-4-yl)carbamic acid (PubChem CID 87349220) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is [(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]methyl-(oxan-4-yl)carbamic acid.
| Compound Name | [(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]methyl-(oxan-4-yl)carbamic acid |
|---|---|
| PubChem CID | 87349220 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]methyl-(oxan-4-yl)carbamic acid |
| SMILES | O=C(NO)[C@H]1CC(CN(C(=O)O)C2CCOCC2)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C25H35N3O6/c29-23(26-33)22-14-17(15-28(25(31)32)20-9-12-34-13-10-20)6-7-21(22)24(30)27-11-8-19(16-27)18-4-2-1-3-5-18/h1-5,17,19-22,33H,6-16H2,(H,26,29)(H,31,32)/t17?,19-,21-,22-/m0/s1 |
| InChIKey | NLROAVUVTXDMFR-OTJOGNACSA-N |
| XLogP | 2.70 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|